For research use only. Not for therapeutic Use.
D609 is a chemical compound with potential therapeutic applications. It acts as an inhibitor of phosphatidylcholine-specific phospholipase C (PC-PLC), a key enzyme involved in cellular signaling pathways. D609 has been studied for its anti-inflammatory and anticancer properties. Further research is ongoing to explore its efficacy and potential clinical uses.
| Catalog Number | I005004 |
| CAS Number | 83373-60-8 |
| Synonyms | potassium O-(octahydro-1H-4,7-methanoinden-5-yl) carbonodithioate |
| Molecular Formula | C11H15OS2 • K |
| Purity | ≥95% |
| Target | Phospholipase |
| Solubility | DMSO：＞ 10 mM |
| Storage | Store at -20°C |
| IC50 | 6.4 uM (Ki) |
| IUPAC Name | potassium;8-tricyclo[5.2.1.02,6]decanyloxymethanedithioate |
| InChI | InChI=1S/C11H16OS2.K/c13-11(14)12-10-5-6-4-9(10)8-3-1-2-7(6)8;/h6-10H,1-5H2,(H,13,14);/q;+1/p-1 |
| InChIKey | IGULCCCBGBDZKQ-UHFFFAOYSA-M |
| SMILES | [S-]C(OC1CC2C(CCC3)C3C1C2)=S.[K+] |
