For research use only. Not for therapeutic Use.
D9 is a high-purity deuterium-labeled compound, widely used in advanced pharmaceutical research and analytical chemistry. Featuring nine deuterium atoms, D9 is essential for studying metabolic pathways, drug interactions, and isotope dilution analysis. This compound offers enhanced stability and precision in various experimental setups, ensuring reliable and consistent results. Ideal for researchers and scientists, D9 facilitates the development of new therapeutics and the study of complex biochemical processes, making it a crucial tool in modern scientific investigations and drug development.
CAS Number | 1527513-89-8 |
Synonyms | (Diphenyl-2-thienylphosphine-κP)[2-(4-methoxyphenyl)ethynyl]gold |
Molecular Formula | C25H21AuOPS |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble to 100 mM in DMSO |
Storage | Store at -20℃ |
IUPAC Name | diphenyl(thiophen-2-yl)phosphane;1-ethynyl-4-methoxybenzene;gold |
InChI | InChI=1S/C16H13PS.C9H8O.Au/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15;1-3-8-4-6-9(10-2)7-5-8;/h1-13H;1,4-7H,2H3; |
InChIKey | HWIUTLSXZCXKKH-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C#C.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CS3.[Au] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |