For research use only. Not for therapeutic Use.
DAB-Am-4, polypropylenimine tetraamine dendrimer, generation 1.0（Cat No.:M017509）, is an early-stage dendrimer, a highly branched, synthetic macromolecule characterized by its regular and highly ordered tree-like structure. As a first-generation dendrimer, it features a core of diamino butane (DAB) surrounded by polypropylene imine branches ending in amine groups. These terminal amine groups provide multiple reactive sites for further functionalization. Dendrimers like DAB-Am-4 are used in a variety of applications, including drug delivery systems, due to their ability to encapsulate therapeutic agents within their structure, and in nanotechnology for precise molecular engineering.
| CAS Number | 120239-63-6 |
| Molecular Formula | C16H40N6 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | N,N,N',N'-tetrakis(3-aminopropyl)butane-1,4-diamine |
| InChI | InChI=1S/C16H40N6/c17-7-3-13-21(14-4-8-18)11-1-2-12-22(15-5-9-19)16-6-10-20/h1-20H2 |
| InChIKey | LYBWJVKFJAIODE-UHFFFAOYSA-N |
| SMILES | C(CCN(CCCN)CCCN)CN(CCCN)CCCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
