For research use only. Not for therapeutic Use.
Dabuzalgron（Cat No.:I017640）is a selective alpha-1A adrenergic receptor agonist, primarily investigated for its potential to treat conditions such as urinary incontinence and benign prostatic hyperplasia (BPH). By selectively stimulating alpha-1A receptors, Dabuzalgron causes smooth muscle contraction in the bladder neck and prostate, which can help improve urinary flow and reduce symptoms of bladder dysfunction. Its selective action minimizes the risk of cardiovascular side effects typically associated with non-selective adrenergic agonists, making it a promising candidate for addressing lower urinary tract symptoms with better tolerability.
| Catalog Number | I017640 |
| CAS Number | 219311-44-1 |
| Molecular Formula | C₁₂H₁₆ClN₃O₃S |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | N-[6-chloro-3-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-2-methylphenyl]methanesulfonamide |
| InChI | InChI=1S/C12H16ClN3O3S/c1-8-10(19-7-11-14-5-6-15-11)4-3-9(13)12(8)16-20(2,17)18/h3-4,16H,5-7H2,1-2H3,(H,14,15) |
| InChIKey | FOYWMEJSRSBQGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1NS(=O)(=O)C)Cl)OCC2=NCCN2 |
| Reference | [1]. Beak J, et al. An Oral Selective Alpha-1A Adrenergic Receptor Agonist Prevents Doxorubicin Cardiotoxicity. JACC Basic Transl Sci. 2017 Feb;2(1):39-53. |
