For research use only. Not for therapeutic Use.
Dacarbazine（Cat No.:A000760）is an alkylating agent used primarily in cancer chemotherapy, particularly for treating melanoma and Hodgkin’s lymphoma. As a prodrug, it undergoes metabolic activation in the liver, forming methylating intermediates that damage DNA, leading to the inhibition of cell replication and tumor growth. Dacarbazine is known for its cytotoxic effects on rapidly dividing cancer cells, making it effective in disrupting tumor progression. It is an essential part of combination therapies and remains a cornerstone in the treatment of specific cancers due to its efficacy and broad therapeutic application.
| Catalog Number | A000760 |
| CAS Number | 4342-03-4 |
| Synonyms | 1H-imidazole-4-carboxamide, 5-(3,3-dimethyl-1-triazenyl)-dacarbazine (unspecified geometry). |
| Molecular Formula | C6H10N6O |
| Purity | ≥95% |
| Target | DNA Synthesis |
| Solubility | >2.3mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 4-(dimethylaminodiazenyl)-1H-imidazole-5-carboxamide |
| InChI | 1S/C6H10N6O/c1-12(2)11-10-6-4(5(7)13)8-3-9-6/h3,11H,1-2H3,(H2,7,13)/b10-6+ |
| InChIKey | OMJKFYKNWZZKTK-UXBLZVDNSA-N |
| SMILES | CN(C)NN=C1C(=NC=N1)C(=O)N |
| Reference | 1: Grob JJ, Mortier L, D/'Hondt L, Grange F, Baurain JF, Dréno B, Lebbe C, Robert C, Dompmartin A, Neyns B, Gillet M, Louahed J, Jarnjak S, Lehmann FF. Safety and immunogenicity of MAGE-A3 cancer immunotherapeutic with dacarbazine in patients with MAGE-A3-positive metastatic cutaneous melanoma: an open phase I/II study with a first assessment of a predictive gene signature. ESMO Open. 2017 Nov 14;2(5):e000203. doi: 10.1136/esmoopen-2017-000203. eCollection 2017. PubMed PMID: 29177094; PubMed Central PMCID: PMC5687540.<br /> |
