For research use only. Not for therapeutic Use.
DAF-FM diacetate (Cat No.:R065917) is a fluorescent dye used to detect and measure nitric oxide (NO) production in biological systems. DAF-FM stands for “diaminofluorescein-FM,” and the diacetate form allows the dye to enter cells where it is hydrolyzed to release the active compound. Upon reaction with NO, DAF-FM emits fluorescence, enabling real-time visualization and quantification of NO levels. This compound has been crucial in studying the role of nitric oxide in various physiological and pathological processes, such as cardiovascular function and inflammation.
| Catalog Number | R065917 |
| CAS Number | 254109-22-3 |
| Synonyms | 4-Amino-5-methylamino-2/’,7/’-difluorofluorescein diacetate;DAF-FM DA |
| Molecular Formula | C25H18F2N2O7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [6'-acetyloxy-4-amino-2',7'-difluoro-5-(methylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
| InChI | InChI=1S/C25H18F2N2O7/c1-10(30)33-20-8-18-13(6-15(20)26)25(12-4-5-17(29-3)23(28)22(12)24(32)36-25)14-7-16(27)21(34-11(2)31)9-19(14)35-18/h4-9,29H,28H2,1-3H3 |
| InChIKey | BEVHTVRRVVEMEF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C2C(=C1)OC3=CC(=C(C=C3C24C5=C(C(=C(C=C5)NC)N)C(=O)O4)F)OC(=O)C)F |
| Reference | 1.Kojima, H.,Urano, Y.,Kikuchi, K., et al. Fluorescent indicators for imaging nitric oxide production. Angewandte Chemistry International Edition English 38(21), 3209-3212 (1999). |
