For research use only. Not for therapeutic Use.
Dagrocorat(CAT: I006372) is a selective glucocorticoid receptor modulator (SGRM) that exhibits anti-inflammatory effects while minimizing the side effects typically associated with traditional glucocorticoids. It acts by selectively modulating the glucocorticoid receptor, providing anti-inflammatory benefits without significantly affecting metabolic or bone-related pathways. Dagrocorat is being studied for its potential in treating autoimmune and inflammatory diseases such as rheumatoid arthritis and inflammatory bowel disease. Its ability to offer targeted therapeutic effects makes it a promising candidate in research aimed at developing safer alternatives to conventional glucocorticoid therapies, reducing long-term side effects like osteoporosis and hyperglycemia.
CAS Number | 1044535-52-5 |
Synonyms | (4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-(2-methylpyridin-3-yl)-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide |
Molecular Formula | C29H29F3N2O2 |
Purity | ≥95% |
InChI | InChI=1S/C29H29F3N2O2/c1-19-25(8-5-15-33-19)34-26(35)22-10-12-24-21(16-22)9-11-23-18-28(36,29(30,31)32)14-13-27(23,24)17-20-6-3-2-4-7-20/h2-8,10,12,15-16,23,36H,9,11,13-14,17-18H2,1H3,(H,34,35)/t23-,27+,28-/m1/s1 |
InChIKey | QJJBNCHSWFGXML-KEKPKEOLSA-N |
SMILES | CC1=C(C=CC=N1)NC(=O)C2=CC3=C(C=C2)C4(CCC(CC4CC3)(C(F)(F)F)O)CC5=CC=CC=C5 |