For research use only. Not for therapeutic Use.
Dalpiciclib（Cat No.:I025523）is a selective inhibitor of cyclin-dependent kinases 4 and 6 (CDK4/6), which are crucial for cell cycle progression and are frequently dysregulated in various cancers. By inhibiting CDK4/6, dalpiciclib effectively blocks the transition from the G1 phase to the S phase of the cell cycle, leading to cell cycle arrest and apoptosis in cancer cells. It has shown significant efficacy in treating hormone receptor-positive breast cancer, often used in combination with endocrine therapies. Dalpiciclib is under investigation in clinical trials to explore its potential in other malignancies as well.
| CAS Number | 1637781-04-4 |
| Synonyms | Dalpiciclib |
| Molecular Formula | C25H30N6O2 |
| Purity | 98% |
| Target | CDK |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperidin-4-ylpyridin-2-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
| InChI | InChI=1S/C25H30N6O2/c1-15-20-14-28-25(29-21-8-7-18(13-27-21)17-9-11-26-12-10-17)30-23(20)31(19-5-3-4-6-19)24(33)22(15)16(2)32/h7-8,13-14,17,19,26H,3-6,9-12H2,1-2H3,(H,27,28,29,30) |
| InChIKey | SGJLSPUSUBJWHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)C4CCNCC4)C5CCCC5)C(=O)C |
