For research use only. Not for therapeutic Use.
Damnacanthal（Cat No.:R057411）is a naturally occurring anthraquinone compound extracted from the root of Morinda citrifolia (noni plant), known for its wide range of biological activities. It exhibits anticancer, anti-inflammatory, and antioxidant properties, making it a focus of research for therapeutic applications. Damnacanthal has been studied for its ability to inhibit key signaling pathways, such as Ras and tyrosine kinases, which are involved in cancer cell proliferation and survival. Additionally, it shows potential in modulating immune responses and protecting against oxidative stress, positioning it as a promising natural compound for drug development.
| Catalog Number | R057411 |
| CAS Number | 477-84-9 |
| Synonyms | 9,10-Dihydro-3-hydroxy-1-methoxy-9,10-dioxo-2-anthracenecarboxaldehyde; 9,10-Dihydro-3-hydroxy-1-methoxy-9,10-dioxo-2-anthraldehyde; 3-Hydroxy-1-methoxy-2-anthraquinonecarboxaldehyde; |
| Molecular Formula | C16H10O5 |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at -20 ℃ |
| IUPAC Name | 3-hydroxy-1-methoxy-9,10-dioxoanthracene-2-carbaldehyde |
| InChI | InChI=1S/C16H10O5/c1-21-16-11(7-17)12(18)6-10-13(16)15(20)9-5-3-2-4-8(9)14(10)19/h2-7,18H,1H3 |
| InChIKey | IPDMWUNUULAXLU-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1C=O)O)C(=O)C3=CC=CC=C3C2=O |
