For research use only. Not for therapeutic Use.
Methotrexate metabolite (DAMPA)(Cat No.:R048569)is the active metabolite of Methotrexate, a folic acid antagonist commonly used as an immunosuppressant. Methotrexate inhibits dihydrofolate reductase, leading to reduced folate levels and disrupting DNA synthesis and cell proliferation. As an immunosuppressant, it is prescribed to treat autoimmune diseases like rheumatoid arthritis, psoriasis, and inflammatory bowel disease. DAMPA is responsible for much of Methotrexate’s therapeutic effects, making it a crucial component in the mechanism of action of this widely used immunosuppressive medication.
CAS Number | 19741-14-1 |
Synonyms | 4-[[(2,4-Diamino-6-pteridinyl)methyl]methylamino]benzoic Acid; 2,4-Diamino-N10-?methylpteroic Acid; 4-Amino-4-deoxy-10-methylpteroic Acid; 4-Amino-4-deoxy-N10-?methylpteroic Acid; 4-Amino-4-deoxy-N10-methylpteroic Acid; 4-Deoxy-4-amino-N10-?methylpte |
Molecular Formula | C15H15N7O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | 2-8°C(protect from light) |
IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid |
InChI | InChI=1S/C15H15N7O2/c1-22(10-4-2-8(3-5-10)14(23)24)7-9-6-18-13-11(19-9)12(16)20-15(17)21-13/h2-6H,7H2,1H3,(H,23,24)(H4,16,17,18,20,21) |
InChIKey | LWCXZSDKANNOAR-UHFFFAOYSA-N |
SMILES | CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |