For research use only. Not for therapeutic Use.
Danofloxacin mesylate（Cat No.:A000878）is a fluoroquinolone antibiotic used in veterinary medicine, particularly for treating respiratory infections in livestock such as cattle and swine. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes necessary for bacterial DNA replication and transcription, leading to bacterial cell death. Danofloxacin mesylate is effective against a range of gram-negative and gram-positive pathogens, making it valuable for controlling respiratory diseases caused by bacteria like Mannheimia haemolytica and Pasteurella multocida. Its strong efficacy and rapid action support animal health and help reduce the spread of infections in agricultural settings.
| Catalog Number | A000878 |
| CAS Number | 119478-55-6 |
| Synonyms | Danofloxacin mesylate; 119478-55-6; Advocin; Danofloxacin (mesylate); UNII-94F3SX3LEM; DANOFLOXACIN MESILATE |
| Molecular Formula | C20H24FN3O6S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxoquinoline-3-carboxylic acid;methanesulfonic acid |
| InChI | InChI=1S/C19H20FN3O3.CH4O3S/c1-21-7-12-4-11(21)8-22(12)17-6-16-13(5-15(17)20)18(24)14(19(25)26)9-23(16)10-2-3-10;1-5(2,3)4/h5-6,9-12H,2-4,7-8H2,1H3,(H,25,26);1H3,(H,2,3,4)/t11-,12-;/m0./s1 |
| InChIKey | APFDJSVKQNSTKF-FXMYHANSSA-N |
| SMILES | CN1C[C@@H]2C[C@H]1CN2C3=C(C=C4C(=C3)N(C=C(C4=O)C(=O)O)C5CC5)F.CS(=O)(=O)O |
| Reference | 1: Wang C, Ai D, Chen C, Lin H, Li J, Shen H, Yi W, Qi Y, Wu H, Cao J. <br> |
