For research use only. Not for therapeutic Use.
Danshensu(Cat No.:I004833) is a water-soluble phenolic acid derived from the root of Salvia miltiorrhiza, commonly known as Danshen, a traditional Chinese medicinal herb. It is known for its strong antioxidant, anti-inflammatory, and cardioprotective properties. Danshensu plays a critical role in promoting blood circulation, reducing oxidative stress, and protecting against ischemic injury, making it valuable in the treatment of cardiovascular diseases such as coronary artery disease and atherosclerosis. Additionally, it exhibits neuroprotective effects and has been studied for its potential benefits in treating neurological conditions. Danshensu is an important bioactive compound in herbal medicine, widely researched for its therapeutic potential in various health conditions.
CAS Number | 76822-21-4 |
Molecular Formula | C9H10O5 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | H2O: ≥ 6.2 mg/mL (Need ultrasonic or warming) |
Storage | Store at -20C |
IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid |
InChI | InChI=1S/C9H10O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8,10-12H,4H2,(H,13,14)/t8-/m1/s1 |
InChIKey | PAFLSMZLRSPALU-MRVPVSSYSA-N |
SMILES | C1=CC(=C(C=C1C[C@H](C(=O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |