For research use only. Not for therapeutic Use.
Dansyl-d6-isopropylamine(Cat No.:R023163) is a deuterated derivative of dansyl-isopropylamine, where six hydrogen atoms are replaced with deuterium. This isotopic modification enhances its stability and is crucial for fluorescence studies and trace analysis in complex biological systems. Dansyl, known for its bright and sensitive fluorescent properties, is widely used in bioanalytical chemistry to label and trace amines. The deuterated version provides improved analytical accuracy, reducing background noise in mass spectrometry and NMR spectroscopy. It’s particularly valuable for studying protein interactions, enzyme activities, and cellular processes, providing clear, quantifiable insights into biochemical pathways.
CAS Number | NA |
Synonyms | DNS-d6-isopropylamine; 5-(Dimethylamino)-N-(1-methylethyl)-1-naphthalenesulfonamide-d6 |
Molecular Formula | C₁₅H₁₄D₆N₂O₂S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-[bis(trideuteriomethyl)amino]-N-propan-2-ylnaphthalene-1-sulfonamide |
InChI | InChI=1S/C15H20N2O2S/c1-11(2)16-20(18,19)15-10-6-7-12-13(15)8-5-9-14(12)17(3)4/h5-11,16H,1-4H3/i3D3,4D3 |
InChIKey | YUYCKXJQNHMBOC-LIJFRPJRSA-N |
SMILES | CC(C)NS(=O)(=O)C1=CC=CC2=C1C=CC=C2N(C)C |