For research use only. Not for therapeutic Use.
Dansylamidoethyl Methanethiosulfonate is a high-purity reagent essential for advanced biochemical and molecular biology research. This compound is crucial for studies involving protein labeling, fluorescence spectroscopy, and enzyme activity assays. Known for its stability and specific reactivity with thiol groups, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| CAS Number | 355115-41-2 |
| Synonyms | MTS-Dansyl; 2-(5-Dimethylaminonaphth-1-ylsulfonamido)ethyl Methanethiosulfonate; Methanesulfonothioic Acid S-[2-[[[5-(Dimethylamino)-1-naphthalenyl]sulfonyl]amino]ethyl]ester; |
| Molecular Formula | C15H20N2O4S3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-(dimethylamino)-N-(2-methylsulfonylsulfanylethyl)naphthalene-1-sulfonamide |
| InChI | InChI=1S/C15H20N2O4S3/c1-17(2)14-8-4-7-13-12(14)6-5-9-15(13)24(20,21)16-10-11-22-23(3,18)19/h4-9,16H,10-11H2,1-3H3 |
| InChIKey | ZKELPZYUWUFQLZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NCCSS(=O)(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
