For research use only. Not for therapeutic Use.
Dansylsarcosine(Cat No.:M068873), also known as Dns-sarcosine, is a fluorescent derivative of sarcosine, an amino acid derivative. Its molecular structure consists of a dansyl fluorophore attached to the sarcosine molecule. Dansylsarcosine is widely utilized in biochemical and biomedical research as a fluorescent probe due to its unique properties. It is commonly employed to label peptides, proteins, and other biomolecules for fluorescence detection, quantification, and localization in biological samples. Additionally, dansylsarcosine finds applications in studying cellular processes, protein-protein interactions, and drug delivery systems, contributing significantly to advancements in molecular biology and biotechnology.
CAS Number | 1093-96-5 |
Molecular Formula | C15H18N2O4S |
Purity | 98% |
Documentation | |
Storage | -20°C |
Related CAS | 4272-77-9 34523-28-9 1091-85-6 605-65-2 |
IUPAC Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-methylamino]acetic acid |
InChI | InChI=1S/C15H18N2O4S/c1-16(2)13-8-4-7-12-11(13)6-5-9-14(12)22(20,21)17(3)10-15(18)19/h4-9H,10H2,1-3H3,(H,18,19) |
InChIKey | BRLJKBOXIVONAG-UHFFFAOYSA-N |
SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N(C)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |