For research use only. Not for therapeutic Use.
Danthron（Cat No.:I000607）is an anthraquinone derivative with laxative properties, primarily used to stimulate bowel movements by increasing intestinal peristalsis. It acts as a stimulant laxative by irritating the colon lining, promoting water and electrolyte secretion, and accelerating bowel evacuation. While once commonly used in over-the-counter laxative formulations, Danthron has been largely restricted due to concerns about its potential carcinogenicity in long-term use. Despite its decline in therapeutic applications, Danthron remains a useful chemical in research for studying intestinal motility and its mechanisms of action.
| Catalog Number | I000607 |
| CAS Number | 117-10-2 |
| Molecular Formula | C14H8O4 |
| Purity | ≥95% |
| Solubility | DMSO:42mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 1,8-dihydroxyanthracene-9,10-dione |
| InChI | InChI=1S/C14H8O4/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16/h1-6,15-16H |
| InChIKey | QBPFLULOKWLNNW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O |
| Reference | <p style=/line-height:25px/> |
