For research use only. Not for therapeutic Use.
DAOS (CAT: I013907) is a novel aniline derivative that functions as a highly water-soluble Trinder’s reagent. Trinder’s reagents are chemical compounds used in diagnostic and biochemical tests to detect and quantify substances of interest. DAOS, due to its water solubility and unique properties, is widely employed in various diagnostic tests and biochemical assays. Its utilization in these applications allows for accurate measurements and detection of target analytes, contributing to the field of clinical diagnostics and biochemical research.
| Catalog Number | I013907 |
| CAS Number | 83777-30-4 |
| Molecular Formula | C₁₃H₂₀NNaO₆S |
| Purity | ≥95% |
| Target | Biochemical Assay Reagents |
| Solubility | DMSO: ≥ 36 mg/mL |
| IUPAC Name | sodium;3-(N-ethyl-3,5-dimethoxyanilino)-2-hydroxypropane-1-sulfonate |
| InChI | InChI=1S/C13H21NO6S.Na/c1-4-14(8-11(15)9-21(16,17)18)10-5-12(19-2)7-13(6-10)20-3;/h5-7,11,15H,4,8-9H2,1-3H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | HDARHUHTZKLJET-UHFFFAOYSA-M |
| SMILES | CCN(CC(CS(=O)(=O)[O-])O)C1=CC(=CC(=C1)OC)OC.[Na+] |
