For research use only. Not for therapeutic Use.
Dapagliflozin, also known as BMS-512148, is a drug used to treat type 2 diabetes approved in 2012 by FDA. Dapagliflozin inhibits subtype 2 of the sodium-glucose transport proteins (SGLT2) which are responsible for at least 90% of the glucose reabsorption in the kidney. Blocking this transporter mechanism causes blood glucose to be eliminated through the urine. In clinical trials, dapagliflozin lowered HbA1c by 0.6 versus placebo percentage points when added to metformin.
| Catalog Number | A000545 |
| CAS Number | 461432-26-8 |
| Synonyms | 461432-26-8; Forxiga; BMS-512148; Farxiga; BMS 512148 |
| Molecular Formula | C₂₁H₂₅ClO₆ |
| Purity | ≥95% |
| Target | SGLT |
| Solubility | >15.1mg/mL in DMSO |
| Storage | -20°C |
| InChI | InChI=1S/C21H25ClO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JVHXJTBJCFBINQ-ADAARDCZSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)C3C(C(C(C(O3)CO)O)O)O)Cl |
| Reference | 1: Miyaoka D, Tsuda A, Hayashi N, Toi N, Yamasaki A, Nagata Y, Nakatani S, 2: Hayashi T, Fukui T, Nakanishi N, Yamamoto S, Tomoyasu M, Osamura A, Ohara M, 3: Pleros C, Stamataki E, Papadaki A, Damianakis N, Poulidaki R, Gakiopoulou C, 4: Min SH, Oh TJ, Baek SI, Lee DH, Kim KM, Moon JH, Choi SH, Park KS, Jang HC, 5: Solini A, Giannini L, Seghieri M, Vitolo E, Taddei S, Ghiadoni L, Bruno RM. 6: CORRIGENDUM FOR /Dapagliflozin lowers plasma glucose concentration and 7: Díaz-Rodríguez E, Agra RM, Fernández áL, Adrio B, García-Caballero T, 8: Scheen AJ. Dapagliflozin and saxagliptin tablets for adults with type 2 9: Gaspari T, Spizzo I, Liu H, Hu Y, Simpson RW, Widdop RE, Dear AE. <br> |
