For research use only. Not for therapeutic Use.
Daphnetin(CAT: I006687) is a natural coumarin derivative known for its diverse pharmacological activities. Structurally, it is 7,8-dihydroxycoumarin, featuring hydroxyl groups at the 7- and 8-positions on the coumarin scaffold. Daphnetin is widely studied for its anti-inflammatory, antioxidant, anticoagulant, and anticancer properties, making it a promising compound in medicinal chemistry. It has been investigated for its role in modulating signaling pathways, such as NF-κB and MAPK, as well as for its effects on cellular processes like apoptosis and angiogenesis. With its high bioactivity and potential therapeutic applications, Daphnetin is a valuable compound for researchers exploring innovative treatments for inflammatory diseases, cardiovascular disorders, and cancer.
CAS Number | 486-35-1 |
Molecular Formula | C9H6O4 |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
Storage | -20℃ |
IUPAC Name | 7,8-dihydroxychromen-2-one |
InChI | InChI=1S/C9H6O4/c10-6-3-1-5-2-4-7(11)13-9(5)8(6)12/h1-4,10,12H |
InChIKey | ATEFPOUAMCWAQS-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1C=CC(=O)O2)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |