For research use only. Not for therapeutic Use.
Daphnoretin（Cat No.:R008157）is a natural compound extracted from the plant Daphne genkwa, recognized for its various biological activities. It exhibits significant anti-inflammatory, antioxidant, and anticancer properties, making it a subject of interest in pharmacological research. Daphnoretin has been shown to inhibit the growth of several cancer cell lines and reduce oxidative stress, potentially providing protective effects against chronic diseases. Additionally, its ability to modulate signaling pathways involved in inflammation and cell survival highlights its therapeutic potential. Ongoing studies aim to explore its mechanisms of action and potential applications in medicine.
| Catalog Number | R008157 |
| CAS Number | 2034-69-7 |
| Molecular Formula | C19H12O7 |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| Storage | Store at -20°C |
| IUPAC Name | 7-hydroxy-6-methoxy-3-(2-oxochromen-7-yl)oxychromen-2-one |
| InChI | InChI=1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3 |
| InChIKey | JRHMMVBOTXEHGJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(C(=O)O2)OC3=CC4=C(C=C3)C=CC(=O)O4)O |
