For research use only. Not for therapeutic Use.
Dasatinib Hydrochloride（Cat No.:I005127）is a potent, broad-spectrum tyrosine kinase inhibitor that targets BCR-ABL, Src family kinases, and other key receptors involved in cancer cell proliferation. It is primarily used in the treatment of chronic myeloid leukemia (CML) and Philadelphia chromosome-positive acute lymphoblastic leukemia (Ph+ ALL). By inhibiting the BCR-ABL fusion protein, dasatinib halts abnormal cell growth, offering a powerful option for patients resistant or intolerant to prior therapies. Its ability to target multiple kinases enhances its efficacy in overcoming drug resistance and managing various hematologic malignancies.
| Catalog Number | I005127 |
| CAS Number | 854001-07-3 |
| Synonyms | (Z)-N-(2-chloro-6-methylphenyl)-2-((6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-yl)amino)thiazole-5-carbimidic acid hydrochloride |
| Molecular Formula | C22H27Cl2N7O2S |
| Purity | ≥95% |
| Target | Src |
| Solubility | DMSO: ≤ 15 mg/mL |
| Storage | Store at -20°C |
| IC50 | ＜1 nM/0.8 nM(Abl/ Src); 79 nM/37 nM (c-Kit WT/c-Kit D816V) |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide;hydrochloride |
| InChI | InChI=1S/C22H26ClN7O2S.ClH/c1-14-4-3-5-16(23)20(14)28-21(32)17-13-24-22(33-17)27-18-12-19(26-15(2)25-18)30-8-6-29(7-9-30)10-11-31;/h3-5,12-13,31H,6-11H2,1-2H3,(H,28,32)(H,24,25,26,27);1H |
| InChIKey | MSCGWICDJYLQOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)NC(=O)C2=CN=C(S2)NC3=CC(=NC(=N3)C)N4CCN(CC4)CCO.Cl |
| Reference | <p style=/line-height:25px/> |
