For research use only. Not for therapeutic Use.
Dasolampanel(CAT: I006398) is a selective, non-competitive antagonist of the AMPA receptor, a subtype of glutamate receptor involved in excitatory neurotransmission in the central nervous system. By modulating AMPA receptor activity, Dasolampanel reduces excitotoxicity, a process implicated in various neurological disorders. This mechanism makes it a valuable tool in neuropharmacology research, particularly for studying conditions such as epilepsy, neuropathic pain, and neurodegenerative diseases. Its potential to attenuate overactive glutamatergic signaling without widespread inhibition offers insights into targeted therapeutic strategies for excitatory neurotransmission-related pathologies.
Catalog Number | I006398 |
CAS Number | 503294-13-1 |
Synonyms | NGX-426; NGX 426; NGX426; Dasolampanel;(3S,4aS,6S,8aR)-6-(3-chloro-2-(1H-tetrazol-5-yl)phenoxy)-decahydroisoquinoline-3-carboxylic acid |
Molecular Formula | C17H20ClN5O3 |
Purity | ≥95% |
Target | AMPA antagonist |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4°C for short term or -20 °C for long term |
IUPAC Name | (3S,4aS,6S,8aR)-6-[3-chloro-2-(2H-tetrazol-5-yl)phenoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
InChI | InChI=1S/C17H20ClN5O3/c18-12-2-1-3-14(15(12)16-20-22-23-21-16)26-11-5-4-9-8-19-13(17(24)25)7-10(9)6-11/h1-3,9-11,13,19H,4-8H2,(H,24,25)(H,20,21,22,23)/t9-,10+,11-,13-/m0/s1 |
InChIKey | LAKQPSQCICNZII-NOHGZBONSA-N |
SMILES | C1CC2CNC(CC2CC1OC3=C(C(=CC=C3)Cl)C4=NNN=N4)C(=O)O |