For research use only. Not for therapeutic Use.
Daurisoline(CAT: R054011) is an alkaloid compound found in various plant species, including Menispermum dauricum. Its mode of action and pharmacological effects can involve interactions with cellular receptors and signaling pathways due to its specific chemical structure. Daurisoline has been explored for its potential medicinal properties, including anti-inflammatory, neuroprotective, and anti-tumor activities. It also exhibits calcium channel-blocking effects, suggesting potential use in cardiovascular conditions.
CAS Number | 70553-76-3 |
Molecular Formula | C37H42N2O6 |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
Storage | -20°C |
IUPAC Name | (1R)-1-[[3-[4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-4-hydroxyphenyl]methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol |
InChI | 1S/C37H42N2O6/c1-38-15-13-26-20-36(43-4)37(44-5)22-29(26)30(38)16-23-6-9-27(10-7-23)45-35-18-24(8-11-32(35)40)17-31-28-21-33(41)34(42-3)19-25(28)12-14-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1 |
InChIKey | BURJAQFYNVMZDV-FIRIVFDPSA-N |
SMILES | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)OC)O)O)OC)OC |