For research use only. Not for therapeutic Use.
D: B-Friedo-B/’:A/’-neogammacer-5-en-3β-ol (Cat No.:M123937) is a complex and specialized organic compound. Its unique structure suggests a triterpenoid or steroid nature, characterized by fused rings and multiple functional groups. While specific applications and properties might be less documented due to the compound’s complexity and rarity, similar compounds with terpenoid structures often exhibit biological activities, including antimicrobial, anti-inflammatory, and cytotoxic effects.
| Catalog Number | M123937 |
| CAS Number | 1615-94-7 |
| Molecular Formula | C30H50O |
| Purity | ≥95% |
| Target | Plants |
| Storage | -20°C |
| IUPAC Name | (3R,3aR,5aR,5bS,9S,11aS,11bR,13aS,13bR)-3a,5a,8,8,11b,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,9,10,11,11a,12,13,13b-tetradecahydrocyclopenta[a]chrysen-9-ol |
| InChI | InChI=1S/C30H50O/c1-19(2)20-9-12-23-27(20,5)15-17-30(8)24-13-10-21-22(11-14-25(31)26(21,3)4)28(24,6)16-18-29(23,30)7/h10,19-20,22-25,31H,9,11-18H2,1-8H3/t20-,22-,23-,24+,25+,27-,28+,29+,30-/m1/s1 |
| InChIKey | XVXPXUMUGATHPD-JMJRLLIOSA-N |
| SMILES | CC(C)C1CCC2C1(CCC3(C2(CCC4(C3CC=C5C4CCC(C5(C)C)O)C)C)C)C |
