For research use only. Not for therapeutic Use.
DBCO-NHS Ester (CAT: R030920) is a versatile cleavable ADC linker designed for the synthesis of antibody-drug conjugates (ADCs), enabling precise drug delivery in targeted cancer therapies. Its NHS ester group facilitates efficient conjugation with primary amines on antibodies or proteins, while the DBCO moiety allows for bioorthogonal strain-promoted copper-free azide-alkyne cycloaddition (SPAAC) reactions. This copper-free “click” chemistry ensures biocompatibility and stability, making it ideal for oncology research and therapeutic development. DBCO-NHS Ester supports the creation of stable, high-performance ADCs and bioconjugates, advancing targeted drug delivery and molecular imaging applications.
CAS Number | 1353016-71-3 |
Synonyms | 11,12-Didehydro-oxo-Dibenz[b,f]azocine-5(6H)-butanoic Acid 2,5-Dioxo-1-pyrrolidinyl Ester |
Molecular Formula | C23H18N2O5 |
Purity | ≥95% |
Target | ADC Linker |
Storage | -20°C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoate |
InChI | InChI=1S/C23H18N2O5/c26-20(13-14-23(29)30-25-21(27)11-12-22(25)28)24-15-18-7-2-1-5-16(18)9-10-17-6-3-4-8-19(17)24/h1-8H,11-15H2 |
InChIKey | XCEBOJWFQSQZKR-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |