For research use only. Not for therapeutic Use.
DBCO-NHS ester (Cat. No: R030920) is a cleavable ADC linker for the synthesis of antibody-conjugated drugs (ADCs). It can also be used in click chemical reactions, such as strain-promoted copper-free azide-alkyne cycloaddition reactions.
| Catalog Number | R030920 |
| CAS Number | 1353016-71-3 |
| Synonyms | 11,12-Didehydro-oxo-Dibenz[b,f]azocine-5(6H)-butanoic Acid 2,5-Dioxo-1-pyrrolidinyl Ester |
| Molecular Formula | C23H18N2O5 |
| Purity | ≥95% |
| Target | ADC Linker |
| Storage | -20°C |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoate |
| InChI | InChI=1S/C23H18N2O5/c26-20(13-14-23(29)30-25-21(27)11-12-22(25)28)24-15-18-7-2-1-5-16(18)9-10-17-6-3-4-8-19(17)24/h1-8H,11-15H2 |
| InChIKey | XCEBOJWFQSQZKR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Yan, Junhong, et al. "A universal approach to prepare reagents for DNA-assisted protein analysis." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>PloS one</i> 9.9 (2014): e108061.<br /> |
