For research use only. Not for therapeutic Use.
DBCO-PEG4-Maleimide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. DBCO-PEG4-Maleimide is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker.
| Catalog Number | I017173 |
| CAS Number | 1480516-75-3 |
| Synonyms | N-[2-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| Molecular Formula | C36H42N4O9 |
| Purity | ≥95% |
| InChI | InChI=1S/C36H42N4O9/c41-32(14-18-39-34(43)11-12-35(39)44)38-17-20-47-22-24-49-26-25-48-23-21-46-19-15-33(42)37-16-13-36(45)40-27-30-7-2-1-5-28(30)9-10-29-6-3-4-8-31(29)40/h1-8,11-12H,13-27H2,(H,37,42)(H,38,41) |
| InChIKey | VVFZXPZWVJMYPX-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)CCOCCOCCOCCOCCNC(=O)CCN4C(=O)C=CC4=O |
| Reference | [1]. Xiaotian Zhong, et al. Capped and uncapped antibody cysteines, and their use in antibody-drug conjugation. WO2017025897A2. |
