For research use only. Not for therapeutic Use.
DBHDA (CAT: I011390) is a reagent commonly used in synthetic biology applications. It is particularly useful for converting cysteine residues to dehydroalanine (Dha) in proteins. This chemical transformation can be employed to introduce specific modifications or functional groups into proteins, allowing researchers to study and manipulate protein structure and function.
| Catalog Number | I011390 |
| CAS Number | 99584-96-0 |
| Synonyms | 2,5-Dibromohexanediamide |
| Molecular Formula | C6H10Br2N2O2 |
| Purity | ≥95% |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at +4C |
| IUPAC Name | 2,5-dibromohexanediamide |
| InChI | InChI=1S/C6H10Br2N2O2/c7-3(5(9)11)1-2-4(8)6(10)12/h3-4H,1-2H2,(H2,9,11)(H2,10,12) |
| InChIKey | PLSXNAQEJOGNKQ-UHFFFAOYSA-N |
| SMILES | C(CC(C(=O)N)Br)C(C(=O)N)Br |
