For research use only. Not for therapeutic Use.
DBIBB is a specific nonlipid agonist of the type 2 G protein coupled receptor for lysophosphatidic acid (LPA2). DBIBB mitigates the gastrointestinal radiation syndrome, increases intestinal crypt survival and enterocyte proliferation, and reduces apoptosis. DBIBB represents a agent candidate capable of mitigating acute radiation syndrome caused by high-dose γ-radiation to the hematopoietic and gastrointestinal system[1].
| Catalog Number | R029700 |
| CAS Number | 1569309-92-7 |
| Synonyms | 2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid |
| Molecular Formula | C23H20N2O6S |
| Purity | ≥95% |
| InChI | InChI=1S/C23H20N2O6S/c26-21-17-10-5-7-15-8-6-11-18(20(15)17)22(27)25(21)14-4-3-13-24-32(30,31)19-12-2-1-9-16(19)23(28)29/h1-2,5-12,24H,3-4,13-14H2,(H,28,29) |
| InChIKey | POLJNARIJSROOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)NCCCCN2C(=O)C3=CC=CC4=C3C(=CC=C4)C2=O |
| Reference | [1]. Patil R, et al. Combined mitigation of the gastrointestinal and hematopoietic acute radiation syndromes by an LPA2 receptor-specific nonlipid agonist. Chem Biol. 2015;22(2):206-216. |
