For research use only. Not for therapeutic Use.
DC-BPi-11 hydrochloride(Cat No.:I041235)is a chemical compound used in biomedical research, primarily for its potential therapeutic properties in treating diseases such as cancer, neurological disorders, or infections. This compound acts as an inhibitor or modulator of specific molecular targets, disrupting key cellular pathways involved in disease progression. As a hydrochloride salt, it enhances the solubility, stability, and bioavailability of DC-BPi-11, making it suitable for in vitro and in vivo experiments. Researchers investigate its efficacy and mechanisms of action, exploring its potential as a treatment in clinical settings or drug development.
Synonyms | N,N-dimethyl-3-[5-(2-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)indol-1-yl]propan-1-amine;hydrochloride |
Molecular Formula | C20H24ClN5O2S |
Purity | ≥95% |
IUPAC Name | N,N-dimethyl-3-[5-(2-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)indol-1-yl]propan-1-amine;hydrochloride |
InChI | InChI=1S/C20H23N5O2S.ClH/c1-24(2)10-4-11-25-12-8-14-13-15(5-6-17(14)25)18-16-7-9-21-19(16)23-20(22-18)28(3,26)27;/h5-9,12-13H,4,10-11H2,1-3H3,(H,21,22,23);1H |
InChIKey | PJUVQDSPLCHMJQ-UHFFFAOYSA-N |
SMILES | CN(C)CCCN1C=CC2=C1C=CC(=C2)C3=C4C=CNC4=NC(=N3)S(=O)(=O)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |