For research use only. Not for therapeutic Use.
DC-CHOL (3β-[N-(N’,N’-dimethylaminoethane)carbamoyl]cholesterol)(Cat No.:M044530)is a synthetic cationic lipid commonly used in gene delivery and liposome-based transfection. This compound features a cholesterol backbone linked to a dimethylaminoethane group, which imparts a positive charge, facilitating the formation of stable lipoplexes with negatively charged DNA or RNA. DC-CHOL is widely used in biomedical research for developing non-viral gene delivery systems, offering a versatile and efficient method for introducing genetic material into cells. It is essential in advancing gene therapy, molecular biology, and nanomedicine research.
Catalog Number | M044530 |
CAS Number | 166023-21-8 |
Molecular Formula | C32H57ClN2O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(dimethylamino)ethyl]carbamate;hydrochloride |
InChI | InChI=1S/C32H56N2O2.ClH/c1-22(2)9-8-10-23(3)27-13-14-28-26-12-11-24-21-25(36-30(35)33-19-20-34(6)7)15-17-31(24,4)29(26)16-18-32(27,28)5;/h11,22-23,25-29H,8-10,12-21H2,1-7H3,(H,33,35);1H/t23-,25+,26+,27-,28+,29+,31+,32-;/m1./s1 |
InChIKey | ISXSJGHXHUZXNF-LXZPIJOJSA-N |
SMILES | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)NCCN(C)C)C)C.Cl |