For research use only. Not for therapeutic Use.
DCAI (Dicarboxylic Acid Inhibitor) (Cat No.: I012687) is a small-molecule inhibitor known for targeting the Wnt/β-catenin signaling pathway, a critical pathway involved in cell proliferation, differentiation, and cancer development. By disrupting the interaction between β-catenin and TCF transcription factors, DCAI suppresses downstream gene expression associated with tumor growth and progression. It has shown potential in preclinical studies for treating cancers with aberrant Wnt signaling. DCAI serves as a valuable research tool in oncology and developmental biology for studying Wnt-mediated cellular processes and therapeutic targeting.
| CAS Number | 299165-92-7 |
| Synonyms | 2-(4,6-Dichloro-2-methyl-1H-indol-3-yl)ethanamine |
| Molecular Formula | C11H12Cl2N2 |
| Purity | ≥95% |
| IUPAC Name | 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine |
| InChI | InChI=1S/C11H12Cl2N2/c1-6-8(2-3-14)11-9(13)4-7(12)5-10(11)15-6/h4-5,15H,2-3,14H2,1H3 |
| InChIKey | JCTJISIFGZHOFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C(C=C2N1)Cl)Cl)CCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
