For research use only. Not for therapeutic Use.
dCeMM2（Cat No.:I043872）is a selective inhibitor of the enzyme cyclin-dependent kinase 8 (CDK8), a member of the CDK family involved in regulating transcription and cell cycle progression. By inhibiting CDK8, dCeMM2 disrupts transcriptional regulation, potentially leading to reduced tumor cell proliferation and survival. It has shown promise in cancer research, particularly in targeting cancers with dysregulated transcriptional pathways. Additionally, dCeMM2 may have applications in inflammatory diseases and conditions involving abnormal cell growth. Its specificity for CDK8 makes it a potential candidate for therapeutic development in oncology and other diseases driven by aberrant transcription.
| CAS Number | 296771-07-8 |
| Synonyms | N-(5-chloropyridin-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
| Molecular Formula | C16H11ClN6OS |
| Purity | ≥95% |
| IUPAC Name | N-(5-chloropyridin-2-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetamide |
| InChI | InChI=1S/C16H11ClN6OS/c17-9-5-6-12(18-7-9)20-13(24)8-25-16-21-15-14(22-23-16)10-3-1-2-4-11(10)19-15/h1-7H,8H2,(H,18,20,24)(H,19,21,23) |
| InChIKey | VFWVTIHYVUKNGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=C(N=N3)SCC(=O)NC4=NC=C(C=C4)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
