For research use only. Not for therapeutic Use.
DDD85646（Cat No.:R064553）is a selective and potent inhibitor of Trypanosoma spp. eukaryotic translation elongation factor 1A (eEF1A), targeting protozoan parasites responsible for diseases such as African sleeping sickness. By disrupting protein synthesis in the parasite, it halts replication and survival, while exhibiting minimal toxicity to human cells. DDD85646 is a valuable tool in parasitology research for studying the biology of trypanosomes and exploring novel therapeutic targets. Its specificity and efficacy highlight its potential for developing targeted treatments for neglected tropical diseases caused by trypanosomatid parasites.
| CAS Number | 1215010-55-1 |
| Synonyms | 2,6-dichloro-4-[2-(1-piperazinyl)-4-pyridinyl]-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)-benzenesulfonamide |
| Molecular Formula | C21H24Cl2N6O2S |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 2,6-dichloro-4-(2-piperazin-1-ylpyridin-4-yl)-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| InChI | InChI=1S/C21H24Cl2N6O2S/c1-13-20(14(2)28(3)26-13)27-32(30,31)21-17(22)10-16(11-18(21)23)15-4-5-25-19(12-15)29-8-6-24-7-9-29/h4-5,10-12,24,27H,6-9H2,1-3H3 |
| InChIKey | XMBSZPZJLPTFMV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)NS(=O)(=O)C2=C(C=C(C=C2Cl)C3=CC(=NC=C3)N4CCNCC4)Cl |
