For research use only. Not for therapeutic Use.
DDO-7263（Cat No.:I043881）is a selective inhibitor of the protein kinase C (PKC) isoform PKCθ, which plays a significant role in T-cell activation and immune response regulation. By targeting PKCθ, DDO-7263 modulates immune cell signaling, potentially reducing inflammation and autoimmunity. It has shown promise in preclinical studies for treating autoimmune diseases, such as rheumatoid arthritis and psoriasis, by preventing excessive immune activation. Additionally, DDO-7263 is being explored for its potential in cancer therapy, particularly in modulating the immune response within the tumor microenvironment to enhance antitumor immunity.
| CAS Number | 2254004-96-9 |
| Synonyms | 5-(3,4-difluorophenyl)-3-(6-methylpyridin-3-yl)-1,2,4-oxadiazole |
| Molecular Formula | C14H9F2N3O |
| Purity | ≥95% |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-(6-methylpyridin-3-yl)-1,2,4-oxadiazole |
| InChI | InChI=1S/C14H9F2N3O/c1-8-2-3-10(7-17-8)13-18-14(20-19-13)9-4-5-11(15)12(16)6-9/h2-7H,1H3 |
| InChIKey | HITVBBDLWZDVIV-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=NOC(=N2)C3=CC(=C(C=C3)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
