For research use only. Not for therapeutic Use.
Decabromodiphenyl ethane (Cat No.:I025712) is a brominated flame retardant widely employed in various industries. It is added to thermoplastics, thermosets, textiles, and coatings to enhance their fire resistance and inhibit the spread of fires. DBDPE acts by releasing bromine radicals when exposed to high temperatures, which interrupt the combustion process and suppress the ignition and propagation of flames. Due to its effectiveness in fire prevention, DBDPE finds extensive use in applications where fire safety is paramount, such as building materials, electronics, and transportation sectors.
| Catalog Number | I025712 |
| CAS Number | 84852-53-9 |
| Synonyms | Decabromodiphenyl ethane; DBDPE; DeBDethane; EC 284-366-9; EINECS 284-366-9; FIREMASTER 2100; SAYTEX 8010. |
| Molecular Formula | C14H6Br10 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Room Temperature |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-[2-(2,3,4,5,6-pentabromophenyl)ethyl]benzene |
| InChI | InChI=1S/C14H4Br10/c15-5-3(6(16)10(20)13(23)9(5)19)1-2-4-7(17)11(21)14(24)12(22)8(4)18/h1-2H2 |
| InChIKey | BZQKBFHEWDPQHD-UHFFFAOYSA-N |
| SMILES | C(CC1=C(C(=C(C(=C1Br)Br)Br)Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
