For research use only. Not for therapeutic Use.
Decahydroquinoline-2-carboxylic acid(Cat No.:L007341), is a significant chemical compound used in various research and industrial applications. This compound is a derivative of quinoline, a heterocyclic aromatic compound, where one of the hydrogen atoms on the quinoline ring is replaced by a carboxylic acid functional group. This substitution imparts unique chemical properties, making it valuable in the synthesis of pharmaceuticals, agrochemicals, and materials science. Researchers utilize this compound as a building block to create more complex molecules and study its reactivity in organic reactions.
CAS Number | 79799-18-1 |
Molecular Formula | C10H17NO2 |
Purity | ≥95% |
IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxylic acid |
InChI | InChI=1S/C10H17NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h7-9,11H,1-6H2,(H,12,13) |
InChIKey | DIWCUPFNJXAUAE-UHFFFAOYSA-N |
SMILES | C1CCC2C(C1)CCC(N2)C(=O)O |