For research use only. Not for therapeutic Use.
Decamethonium(Cat No.:M067851), also referred to as decamethonium bromide, is a synthetic compound classified as a depolarizing neuromuscular blocking agent. Structurally, it consists of a decamethylene chain with quaternary ammonium groups at each end. Decamethonium acts similarly to acetylcholine, binding to nicotinic acetylcholine receptors at the neuromuscular junction, leading to depolarization and subsequent muscle paralysis. It was historically used as a muscle relaxant during surgical procedures, but its clinical use has largely been discontinued due to side effects such as bradycardia, hypotension, and prolonged respiratory paralysis.
Catalog Number | M067851 |
CAS Number | 156-74-1 |
Molecular Formula | C16H38N2+2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | trimethyl-[10-(trimethylazaniumyl)decyl]azanium |
InChI | InChI=1S/C16H38N2/c1-17(2,3)15-13-11-9-7-8-10-12-14-16-18(4,5)6/h7-16H2,1-6H3/q+2 |
InChIKey | MTCUAOILFDZKCO-UHFFFAOYSA-N |
SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C |