For research use only. Not for therapeutic Use.
Decanoic acid, also known as capric acid, is a saturated fatty acid with ten carbon atoms. Found naturally in various sources like coconut oil and dairy products, it serves multiple purposes, including as a flavoring agent and antimicrobial preservative. Beyond its culinary applications, decanoic acid has garnered interest in pharmaceutical research for its potential therapeutic effects, particularly in neurological disorders like epilepsy. Its unique properties make it a versatile compound with diverse industrial and medical applications, driving ongoing exploration into its potential benefits and uses.
| Catalog Number | R069366 |
| CAS Number | 334-48-5 |
| Synonyms | n-Capric acid |
| Molecular Formula | C10H20O2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | decanoic acid |
| InChI | InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12) |
| InChIKey | GHVNFZFCNZKVNT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)O |
