For research use only. Not for therapeutic Use.
Decarbamoylgonyautoxin-2(Cat No.:T000003)is a naturally occurring marine toxin derived from the decarbamoylation of gonyautoxin-2, primarily found in shellfish. This compound is part of the saxitoxin family, known for causing paralytic shellfish poisoning. Its structure enables the study of ion channel function, particularly sodium channels, which are crucial for neurological signaling. Decarbamoylgonyautoxin-2 is utilized in biomedical research to understand and develop treatments for neurotoxicity and related conditions. Its specific interaction with nerve channels makes it a valuable tool in neuroscience and toxicology studies.
CAS Number | 86996-87-4 |
Synonyms | Decarbamoylgonyautoxin 2; DcGonyautoxin 2 |
Molecular Formula | C9H16N6O7S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(3aS,4R,8S,10aR)-2,6-diamino-9,9-dihydroxy-4-(hydroxymethyl)-3a,4,8,10-tetrahydro-1H-pyrrolo[1,2-c]purin-8-yl] hydrogen sulfate |
InChI | InChI=1S/C9H16N6O7S/c10-6-13-4-3(1-16)12-7(11)15-5(22-23(19,20)21)9(17,18)2-8(4,15)14-6/h3-5,16-18H,1-2H2,(H2,11,12)(H3,10,13,14)(H,19,20,21)/t3-,4-,5-,8+/m0/s1 |
InChIKey | GBRZXCTZYCGMIE-KALNXVOASA-N |
SMILES | C1C23C(C(N=C(N2C(C1(O)O)OS(=O)(=O)O)N)CO)N=C(N3)N |