For research use only. Not for therapeutic Use.
Decarbamoylgonyautoxin-3 (Cat No.:T000004) is a marine toxin produced by certain species of algae, such as Alexandrium and Gymnodinium. It is classified as a saxitoxin and is known to cause paralytic shellfish poisoning (PSP) in humans. dcGTX3 acts by blocking sodium channels in nerve cells, leading to symptoms such as tingling, numbness, and paralysis if ingested. This toxin is closely monitored in shellfish and other seafood to prevent PSP outbreaks, as it can accumulate in these organisms.
CAS Number | 87038-53-7 |
Synonyms | Decarbamoylgonyautoxin 3; DcGonyautoxin 3 |
Molecular Formula | C9 H16 N6 O7 S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] hydrogen sulfate |
InChI | InChI=1S/C9H16N6O7S/c10-6-13-5-3(2-16)12-7(11)15-1-4(22-23(19,20)21)9(17,18)8(5,15)14-6/h3-5,16-18H,1-2H2,(H2,11,12)(H3,10,13,14)(H,19,20,21)/t3-,4-,5-,8-/m0/s1 |
InChIKey | AJLCXXKDNUGKKH-RGDLXGNYSA-N |
SMILES | C1C(C(C23N1C(=NC(C2N=C(N3)N)CO)N)(O)O)OS(=O)(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |