For research use only. Not for therapeutic Use.
Decarbamoylneosaxitoxin is a neurotoxin that belongs to the saxitoxin family, which is responsible for causing paralytic shellfish poisoning (PSP). It is produced by certain species of marine dinoflagellates and cyanobacteria. Decarbamoylneosaxitoxin acts by blocking sodium channels in nerve cells, leading to paralysis and, in severe cases, respiratory failure. It is a subject of study in marine toxicology and environmental science, where it plays a critical role in monitoring seafood safety and understanding harmful algal blooms.
| Catalog Number | T000005 |
| CAS Number | 68683-58-9 |
| Synonyms | Decarbamoylneosaxitoxin; 1-Hydroxydecarbamoylsaxitoxin |
| Molecular Formula | C9H16N6O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3aS,4R,10aS)-2-amino-5-hydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
| InChI | InChI=1S/C9H16N6O4/c10-6-12-5-4(3-16)15(19)7(11)14-2-1-8(17,18)9(5,14)13-6/h4-5,11,16-19H,1-3H2,(H3,10,12,13)/t4-,5-,9-/m0/s1 |
| InChIKey | KUMXVBFFVVLQFX-PJPYAQQDSA-N |
| SMILES | C1CN2C(=N)N(C(C3C2(C1(O)O)NC(=N3)N)CO)O |
