For research use only. Not for therapeutic Use.
Decarbamoylsaxitoxin is a potent neurotoxin from the saxitoxin family, primarily produced by marine dinoflagellates and cyanobacteria. It is one of the toxins responsible for paralytic shellfish poisoning (PSP), which occurs when contaminated shellfish are consumed. Decarbamoylsaxitoxin blocks sodium channels in nerve cells, leading to paralysis and potentially fatal respiratory failure. It is a key focus in marine toxicology, where its detection and quantification are crucial for ensuring seafood safety and managing the risks associated with harmful algal blooms.
| Catalog Number | T000006 |
| CAS Number | 58911-04-9 |
| Synonyms | Decarbamoylsaxitoxin; Decarbamylsaxitoxin; Descarbamoylsaxitoxin |
| Molecular Formula | C9H16N6O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3aS,4R,10aS)-2,6-diamino-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purine-10,10-diol |
| InChI | InChI=1S/C9H16N6O3/c10-6-13-5-4(3-16)12-7(11)15-2-1-8(17,18)9(5,15)14-6/h4-5,16-18H,1-3H2,(H2,11,12)(H3,10,13,14)/t4-,5-,9-/m0/s1 |
| InChIKey | VRRIYZJUSNMZMP-PJPYAQQDSA-N |
| SMILES | C1CN2C(=NC(C3C2(C1(O)O)N=C(N3)N)CO)N |
