For research use only. Not for therapeutic Use.
Decarboxylated S-Adenosylmethionine Sulfate Salt(CAT: R063209) is a derivative of S-adenosylmethionine (SAM), an essential biological molecule involved in methyl group transfers. In its decarboxylated form, this compound plays a crucial role in polyamine biosynthesis, acting as a donor of aminopropyl groups during the formation of polyamines such as spermidine and spermine, which are critical for cell growth and differentiation. The sulfate salt enhances its solubility and stability, making it more suitable for biochemical research and pharmaceutical applications. It is often studied in the context of cellular metabolism, enzymatic reactions, and its potential therapeutic applications in neurodegenerative diseases and cancer.
CAS Number | 67380-81-8 |
Synonyms | 5’-[(3-aminopropyl)methylsulfonio]-5’-deoxy-adenosine Sulfate Salt sulfate(salt) (1:1:1);?(-)-S-Adenosyl-(5’)-3-methylthiopropylamine Sulfate Salt; Decarboxylated AdoMet Sulfate Salt; S-Adenosyl-3-methylthiopropylamine Sulfate Salt; S-Adenosyl-L-meth |
Molecular Formula | C₁₄H₂₄N₆O₇S₂ •H₂SO₄ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-aminopropyl-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;hydrogen sulfate;sulfuric acid |
InChI | InChI=1S/C14H23N6O3S.2H2O4S/c1-24(4-2-3-15)5-8-10(21)11(22)14(23-8)20-7-19-9-12(16)17-6-18-13(9)20;2*1-5(2,3)4/h6-8,10-11,14,21-22H,2-5,15H2,1H3,(H2,16,17,18);2*(H2,1,2,3,4)/q+1;;/p-1/t8-,10-,11-,14-,24?;;/m1../s1 |
InChIKey | NZCXDNATCGDLIE-RGBAOSDGSA-M |
SMILES | C[S+](CCCN)CC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O.OS(=O)(=O)O.OS(=O)(=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |