Dechlorhydroxyzine hydrochloride（Cat No.:I003372）is a derivative of the first-generation antihistamine hydroxyzine. It possesses a potent and selective blocking effect on the H1 receptors, which are involved in allergic reactions. What sets it apart is its long duration of action, providing therapeutic effects for 6 to 12 hours. By blocking H1 receptors, dechlorhydroxyzine hydrochloride effectively mitigates symptoms associated with allergies, such as itching, sneezing, and hives. Its extended duration of action allows for less frequent dosing and improved patient compliance in the management of allergic conditions.
| Catalog Number | I003372 |
| CAS Number | 3733-63-9 |
| Synonyms | 2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethanol |
| Molecular Formula | C21H28N2O2 |
| Purity | ≥95% |
| Target | Histamine Receptor |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethanol |
| InChI | InChI=1S/C21H28N2O2/c24-16-18-25-17-15-22-11-13-23(14-12-22)21(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,21,24H,11-18H2 |
| InChIKey | OXBBIHZWNDPBMQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCCO)C(C2=CC=CC=C2)C3=CC=CC=C3 |
| Reference | <p style=/line-height:25px/> |
