For research use only. Not for therapeutic Use.
Decoquinate（Cat No.:A000532）is an antiprotozoal agent widely used in veterinary medicine to prevent and control coccidiosis in livestock, particularly poultry and cattle. It works by disrupting the mitochondrial electron transport chain in parasites, specifically targeting the sporozoite stage of Eimeria species, which causes coccidiosis. Decoquinate’s targeted action halts parasite development without affecting the host, making it a safe and effective choice for continuous feed inclusion. Its preventive efficacy helps reduce disease outbreaks, improves animal health, and supports higher productivity in agricultural settings by minimizing coccidial infections.
| Catalog Number | A000532 |
| CAS Number | 18507-89-6 |
| Synonyms | NA |
| Molecular Formula | C24H35NO5 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | ethyl 6-decoxy-7-ethoxy-4-oxo-1H-quinoline-3-carboxylate |
| InChI | InChI=1S/C24H35NO5/c1-4-7-8-9-10-11-12-13-14-30-21-15-18-20(16-22(21)28-5-2)25-17-19(23(18)26)24(27)29-6-3/h15-17H,4-14H2,1-3H3,(H,25,26) |
| InChIKey | JHAYEQICABJSTP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)OCC)OCC |
