For research use only. Not for therapeutic Use.
Decursin(Cat No.:M015001)is a coumarin derivative found in the roots of Angelica gigas, a traditional medicinal herb. Known for its diverse pharmacological properties, decursin exhibits anti-inflammatory, anti-cancer, and neuroprotective effects. It works by modulating various cellular pathways, including apoptosis and angiogenesis, making it a potential candidate for cancer therapy. Additionally, decursin has antioxidant properties that help combat oxidative stress, contributing to its neuroprotective benefits. Its broad spectrum of biological activities has garnered interest in developing decursin-based therapeutic agents for treating various diseases and promoting overall health.
CAS Number | 5928-25-6 |
Synonyms | (+)-Decursin, (7S)-7,8-Dihydro-8,8-dimethyl-2-oxo-2H,6H-benzo[1,2-b:5,4-b′]dipyran-7-yl 3-methyl-2-butenoate, 3-Methyl-2-butenoic acid (7S)-7,8-dihydro-8,8-dimethyl-2-oxo-2H,6H-pyrano[3,2-g]-1-benzopyran-7-yl ester |
Molecular Formula | C19H20O5 |
Purity | 97% |
Target | TGF-beta/Smad |
Solubility | DMSO: soluble5 mg/mL, clear |
Storage | 20°C |
Analysis method | HPLC |
IUPAC Name | [(3S)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] 3-methylbut-2-enoate |
InChI | InChI=1S/C19H20O5/c1-11(2)7-18(21)23-16-9-13-8-12-5-6-17(20)22-14(12)10-15(13)24-19(16,3)4/h5-8,10,16H,9H2,1-4H3/t16-/m0/s1 |
InChIKey | CUKSFECWKQBVED-INIZCTEOSA-N |
SMILES | CC(=CC(=O)O[C@H]1CC2=C(C=C3C(=C2)C=CC(=O)O3)OC1(C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |