For research use only. Not for therapeutic Use.
Decursinol (Cat.No:I012685) is a natural compound derived from the root of the angelica plant (Angelica gigas). It possesses various biological activities, including antioxidant, anti-inflammatory, and anticancer properties. Decursinol has shown potential in inhibiting tumor growth and angiogenesis, making it a subject of interest in cancer research. Further studies are ongoing to explore its therapeutic applications.
CAS Number | 23458-02-8 |
Synonyms | (S)-7,8-Dihydro-7-hydroxy-8,8-dimethyl-2H,6H-benzo[1,2-b:5,4-b/’]dipyran-2-one |
Molecular Formula | C14H14O4 |
Purity | ≥95% |
Target | Plants |
IUPAC Name | (3S)-3-hydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one |
InChI | InChI=1S/C14H14O4/c1-14(2)12(15)6-9-5-8-3-4-13(16)17-10(8)7-11(9)18-14/h3-5,7,12,15H,6H2,1-2H3/t12-/m0/s1 |
InChIKey | BGXFQDFSVDZUIW-LBPRGKRZSA-N |
SMILES | CC1(C(CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)O)C |