For research use only. Not for therapeutic Use.
(-)-Decursinol(CAT: I025819) is a natural coumarin derivative primarily isolated from Angelica species, known for its diverse pharmacological properties. It exhibits neuroprotective, anti-inflammatory, and antioxidant activities, making it a valuable compound in neurological and anti-aging research. (-)-Decursinol has been studied for its potential to modulate signaling pathways involved in neuronal survival, inflammation, and oxidative stress, showing promise in preclinical models of neurodegenerative disorders, including Alzheimer’s and Parkinson’s diseases. Its multifunctional mechanism positions it as a critical tool for exploring therapeutic strategies in neuropharmacology and related fields.
| Catalog Number | I025819 |
| CAS Number | 21860-31-1 |
| Synonyms | Decursinol, (-)-; (-)-Decursinol; (-)-Smyrinol; Aegelinol; UNII-I65EAN940H. |
| Molecular Formula | C14H14O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (R)-7-hydroxy-8,8-dimethyl-7,8-dihydro-2H,6H-pyrano[3,2-g]chromen-2-one |
| InChI | InChI=1S/C14H14O4/c1-14(2)12(15)6-9-5-8-3-4-13(16)17-10(8)7-11(9)18-14/h3-5,7,12,15H,6H2,1-2H3/t12-/m1/s1 |
| InChIKey | BGXFQDFSVDZUIW-GFCCVEGCSA-N |
| SMILES | CC1([C@@H](CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)O)C |
