For research use only. Not for therapeutic Use.
Decyclohexanamine-Exatecan（Cat No.:I041176）is an experimental compound that combines the cytotoxic agent Exatecan with a cyclohexanamine linker. This fusion aims to improve the selective delivery of Exatecan to cancer cells while minimizing systemic toxicity. Exatecan is a topoisomerase I inhibitor, and its conjugation with a cyclohexanamine enhances stability and targeting efficiency. The compound is being studied for its potential to treat various cancers by disrupting cancer cell DNA replication and inducing apoptosis. Ongoing clinical trials focus on evaluating its efficacy, safety profile, and therapeutic potential in oncology.
| CAS Number | 2505045-51-0 |
| Synonyms | (19S)-19-ethyl-6-fluoro-19-hydroxy-7-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| Molecular Formula | C21H17FN2O4 |
| Purity | ≥95% |
| IUPAC Name | (19S)-19-ethyl-6-fluoro-19-hydroxy-7-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| InChI | InChI=1S/C21H17FN2O4/c1-3-21(27)14-6-17-18-12(5-11-4-10(2)15(22)7-16(11)23-18)8-24(17)19(25)13(14)9-28-20(21)26/h4-7,27H,3,8-9H2,1-2H3/t21-/m0/s1 |
| InChIKey | GATBZNISYBKSSQ-NRFANRHFSA-N |
| SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=C(C(=CC5=C4)C)F)O |
