For research use only. Not for therapeutic Use.
Deferiprone（Cat No.:A000722） is an oral iron chelator used to treat iron overload in patients with conditions like thalassemia major who require frequent blood transfusions. It works by binding to excess iron in the body, forming a complex that is excreted primarily through urine, thereby reducing iron accumulation in vital organs such as the liver and heart. Deferiprone is effective in lowering serum ferritin levels and improving patient outcomes. Common side effects include gastrointestinal disturbances, joint pain, and a risk of neutropenia. Regular monitoring is essential to manage potential side effects and ensure effective treatment.
| Catalog Number | A000722 |
| CAS Number | 30652-11-0 |
| Synonyms | 30652-11-0; 3-Hydroxy-1,2-dimethyl-4(1H)-pyridone; Ferriprox; 3-hydroxy-1,2-dimethylpyridin-4(1H)-one; CP20 |
| Molecular Formula | C7H9NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-hydroxy-1,2-dimethylpyridin-4-one |
| InChI | InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 |
| InChIKey | TZXKOCQBRNJULO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C=CN1C)O |
